Nabumetone
Catalog No: FT-0629765
CAS No: 42924-53-8
- Chemical Name: Nabumetone
- Molecular Formula: C15H16O2
- Molecular Weight: 228.29
- InChI Key: BLXXJMDCKKHMKV-UHFFFAOYSA-N
- InChI: InChI=1S/C15H16O2/c1-11(16)3-4-12-5-6-14-10-15(17-2)8-7-13(14)9-12/h5-10H,3-4H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 80-81ºC |
|---|---|
| CAS: | 42924-53-8 |
| MF: | C15H16O2 |
| Flash_Point: | 165.4±14.5 °C |
| Product_Name: | Nabumetone |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 228.286 |
| Bolling_Point: | 371.1±17.0 °C at 760 mmHg |
| Refractive_Index: | 1.576 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 165.4±14.5 °C |
| LogP: | 2.82 |
| Bolling_Point: | 371.1±17.0 °C at 760 mmHg |
| FW: | 228.286 |
| PSA: | 26.30000 |
| Melting_Point: | 80-81ºC |
| MF: | C15H16O2 |
| Exact_Mass: | 228.115036 |
| Density: | 1.1±0.1 g/cm3 |
| Risk_Statements(EU): | 22-40 |
|---|---|
| WGK_Germany: | 2 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RTECS: | EL9085000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| HS_Code: | 2914399090 |
| Safety_Statements: | 36/37 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)