![(1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOL-5-YL)METHANOL (CAS: 423769-75-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0604498.png "(1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOL-5-YL)METHANOL chemical structure")
(1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOL-5-YL)METHANOL
Catalog No: FT-0604498
CAS No: 423769-75-9
- Chemical Name: (1,3-DIMETHYL-1H-THIENO[2,3-C]PYRAZOL-5-YL)METHANOL
- Molecular Formula: C8H10N2OS
- Molecular Weight: 182.25
- InChI Key: RRJNXBJUHRCXDW-UHFFFAOYSA-N
- InChI: InChI=1S/C8H10N2OS/c1-5-7-3-6(4-11)12-8(7)10(2)9-5/h3,11H,4H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (1,3-dimethylthieno[2,3-c]pyrazol-5-yl)methanol |
|---|---|
| Flash_Point: | 166.2ºC |
| Melting_Point: | 133-135ºC |
| FW: | 182.24300 |
| Density: | 1.4g/cm3 |
| CAS: | 423769-75-9 |
| Bolling_Point: | 351.2ºC at 760 mmHg |
| MF: | C8H10N2OS |
| Density: | 1.4g/cm3 |
|---|---|
| LogP: | 1.43550 |
| Flash_Point: | 166.2ºC |
| Melting_Point: | 133-135ºC |
| FW: | 182.24300 |
| PSA: | 66.29000 |
| Exact_Mass: | 182.05100 |
| MF: | C8H10N2OS |
| Bolling_Point: | 351.2ºC at 760 mmHg |
| Refractive_Index: | 1.69 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2934999090 |
| Safety_Statements: | S26-S37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)