3-(3,5-dimethylphenyl)propanoic acid
Catalog No: FT-0731512
CAS No: 42287-87-6
- Chemical Name: 3-(3,5-dimethylphenyl)propanoic acid
- Molecular Formula: C11H14O2
- Molecular Weight: 178.23
- InChI Key: CCPNDKXTGJGIIV-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14O2/c1-8-5-9(2)7-10(6-8)3-4-11(12)13/h5-7H,3-4H2,1-2H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 42287-87-6 |
|---|---|
| MF: | C11H14O2 |
| Density: | 1.074g/cm3 |
| Flash_Point: | 202.7ºC |
| Melting_Point: | N/A |
| Product_Name: | 3-(3,5-diMethylphenyl)propanoic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 305.6ºC at 760 mmHg |
| FW: | 178.22800 |
| Density: | 1.074g/cm3 |
|---|---|
| MF: | C11H14O2 |
| LogP: | 2.32060 |
| Exact_Mass: | 178.09900 |
| Bolling_Point: | 305.6ºC at 760 mmHg |
| Flash_Point: | 202.7ºC |
| FW: | 178.22800 |
| Refractive_Index: | 1.534 |
| PSA: | 37.30000 |
| Safety_Statements: | H315-H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2916399090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)