Valnoctamide
Catalog No: FT-0675768
CAS No: 4171-13-5
- Chemical Name: Valnoctamide
- Molecular Formula: C8H17NO
- Molecular Weight: 143.23
- InChI Key: QRCJOCOSPZMDJY-UHFFFAOYSA-N
- InChI: InChI=1S/C8H17NO/c1-4-6(3)7(5-2)8(9)10/h6-7H,4-5H2,1-3H3,(H2,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 4171-13-5 |
| Flash_Point: | 119.8ºC |
| Product_Name: | 2-ethyl-3-methyl-pentanamide Axiquel Nirvanil |
| Bolling_Point: | 274.4ºC at 760mmHg |
| FW: | 143.22700 |
| Melting_Point: | 113.5-114ºC |
| MF: | C8H17NO |
| Density: | 0.883g/cm3 |
| Melting_Point: | 113.5-114ºC |
|---|---|
| Refractive_Index: | 1.438 |
| MF: | C8H17NO |
| Flash_Point: | 119.8ºC |
| LogP: | 2.24430 |
| FW: | 143.22700 |
| Density: | 0.883g/cm3 |
| PSA: | 43.09000 |
| Bolling_Point: | 274.4ºC at 760mmHg |
| Exact_Mass: | 143.13100 |
| Symbol: | GHS07 |
|---|---|
| RTECS: | YV5950000 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924199090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)