4-Chloro-isatoic anhydride
Catalog No: FT-0639682
CAS No: 40928-13-0
- Chemical Name: 4-Chloro-isatoic anhydride
- Molecular Formula: C8H4ClNO3
- Molecular Weight: 197.57
- InChI Key: QRUPDIJQZCABTC-UHFFFAOYSA-N
- InChI: InChI=1S/C8H4ClNO3/c9-4-1-2-5-6(3-4)10-8(12)13-7(5)11/h1-3H,(H,10,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 40928-13-0 |
| Flash_Point: | N/A |
| Product_Name: | 4-Chloro-isatoic anhydride |
| Bolling_Point: | N/A |
| FW: | 197.575 |
| Melting_Point: | 255-259ºC |
| MF: | C8H4ClNO3 |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 255-259ºC |
|---|---|
| Refractive_Index: | 1.601 |
| MF: | C8H4ClNO3 |
| Exact_Mass: | 196.987976 |
| LogP: | 1.93 |
| FW: | 197.575 |
| Density: | 1.5±0.1 g/cm3 |
| PSA: | 63.07000 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| HS_Code: | 2934999090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)