[2-(Morpholin-4-ylcarbonyl)phenyl]amine
Catalog No: FT-0677468
CAS No: 39630-24-5
- Chemical Name: [2-(Morpholin-4-ylcarbonyl)phenyl]amine
- Molecular Formula: C11H14N2O2
- Molecular Weight: 206.24
- InChI Key: LFLIOZKEABTZIF-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14N2O2/c12-10-4-2-1-3-9(10)11(14)13-5-7-15-8-6-13/h1-4H,5-8,12H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 206.24100 |
| Density: | 1.228g/cm3 |
| CAS: | 39630-24-5 |
| Bolling_Point: | 411.6ºC at 760 mmHg |
| Product_Name: | 2-(4-Morpholinylcarbonyl)aniline |
| Melting_Point: | N/A |
| Flash_Point: | 202.7ºC |
| MF: | C11H14N2O2 |
| Density: | 1.228g/cm3 |
|---|---|
| LogP: | 1.26030 |
| Flash_Point: | 202.7ºC |
| Refractive_Index: | 1.6 |
| FW: | 206.24100 |
| PSA: | 55.56000 |
| MF: | C11H14N2O2 |
| Bolling_Point: | 411.6ºC at 760 mmHg |
| Exact_Mass: | 206.10600 |
| Hazard_Codes: | Xi |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)