2-methoxy-p-toluidine
Catalog No: FT-0686990
CAS No: 39538-68-6
- Chemical Name: 2-methoxy-p-toluidine
- Molecular Formula: C8H11NO
- Molecular Weight: 137.18
- InChI Key: CJJLEUQMMMLOFI-UHFFFAOYSA-N
- InChI: InChI=1S/C8H11NO/c1-6-3-4-7(9)8(5-6)10-2/h3-5H,9H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 39538-68-6 |
| Flash_Point: | 103.3±15.0 °C |
| Product_Name: | 2-Methoxy-4-methylaniline |
| Bolling_Point: | 236.9±20.0 °C at 760 mmHg |
| FW: | 137.179 |
| Melting_Point: | N/A |
| MF: | C8H11NO |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.549 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C8H11NO |
| Flash_Point: | 103.3±15.0 °C |
| LogP: | 1.55 |
| FW: | 137.179 |
| Density: | 1.0±0.1 g/cm3 |
| PSA: | 35.25000 |
| Bolling_Point: | 236.9±20.0 °C at 760 mmHg |
| Exact_Mass: | 137.084061 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922299090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)