3-Nitro-2-pyridinethiol
Catalog No: FT-0648565
CAS No: 38240-29-8
- Chemical Name: 3-Nitro-2-pyridinethiol
- Molecular Formula: C5H4N2O2S
- Molecular Weight: 156.16
- InChI Key: LKNPLDRVWHXGKZ-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4N2O2S/c8-7(9)4-2-1-3-6-5(4)10/h1-3H,(H,6,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 38240-29-8 |
| Flash_Point: | 126.3±23.2 °C |
| Product_Name: | 3-nitropyridine-2-thiol |
| Bolling_Point: | 285.3±25.0 °C at 760 mmHg |
| FW: | 156.163 |
| Melting_Point: | 173-174ºC |
| MF: | C5H4N2O2S |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 173-174ºC |
|---|---|
| Refractive_Index: | 1.650 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C5H4N2O2S |
| Flash_Point: | 126.3±23.2 °C |
| LogP: | 1.62 |
| FW: | 156.163 |
| Density: | 1.5±0.1 g/cm3 |
| PSA: | 97.51000 |
| Bolling_Point: | 285.3±25.0 °C at 760 mmHg |
| Exact_Mass: | 155.999344 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)