Bosutinib
Catalog No: FT-0656231
CAS No: 380843-75-4
- Chemical Name: Bosutinib
- Molecular Formula: C26H29Cl2N5O3
- Molecular Weight: 530.4
- InChI Key: UBPYILGKFZZVDX-UHFFFAOYSA-N
- InChI: InChI=1S/C26H29Cl2N5O3/c1-32-6-8-33(9-7-32)5-4-10-36-25-13-21-18(11-24(25)35-3)26(17(15-29)16-30-21)31-22-14-23(34-2)20(28)12-19(22)27/h11-14,16H,4-10H2,1-3H3,(H,30,31)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 530.446 |
|---|---|
| CAS: | 380843-75-4 |
| Flash_Point: | 346.7±31.5 °C |
| MF: | C26H29Cl2N5O3 |
| Symbol: | Warning |
| Bolling_Point: | 649.7±55.0 °C at 760 mmHg |
| Melting_Point: | 116-120ºC |
| Product_Name: | Bosutinib |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 530.446 |
|---|---|
| MF: | C26H29Cl2N5O3 |
| Exact_Mass: | 529.164734 |
| Flash_Point: | 346.7±31.5 °C |
| LogP: | 5.48 |
| PSA: | 82.88000 |
| Vapor_Pressure: | 0.0±1.9 mmHg at 25°C |
| Bolling_Point: | 649.7±55.0 °C at 760 mmHg |
| Melting_Point: | 116-120ºC |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.652 |
| Symbol: | Warning |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H319-H413 |
| Warning_Statement: | P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)