2-(3-THIENYLTHIO)THIOPHENE
Catalog No: FT-0608567
CAS No: 3807-37-2
- Chemical Name: 2-(3-THIENYLTHIO)THIOPHENE
- Molecular Formula: C8H6S3
- Molecular Weight: 198.3
- InChI Key: XZMYDSUNRUYCNA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6S3/c1-2-8(10-4-1)11-7-3-5-9-6-7/h1-6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-thiophen-3-ylsulfanylthiophene |
|---|---|
| Flash_Point: | 144.3ºC |
| Melting_Point: | N/A |
| FW: | 198.32800 |
| Density: | 1.37g/cm3 |
| CAS: | 3807-37-2 |
| Bolling_Point: | 315ºC at 760mmHg |
| MF: | C8H6S3 |
| Density: | 1.37g/cm3 |
|---|---|
| LogP: | 3.96080 |
| Flash_Point: | 144.3ºC |
| Refractive_Index: | 1.697 |
| FW: | 198.32800 |
| PSA: | 81.78000 |
| MF: | C8H6S3 |
| Bolling_Point: | 315ºC at 760mmHg |
| Exact_Mass: | 197.96300 |
| HS_Code: | 2934999090 |
|---|---|
| Safety_Statements: | S24/25 |