![thieno[3,2-b]thiophene-2,5-dicarbaldehyde (CAS: 37882-75-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0704440.png "thieno[3,2-b]thiophene-2,5-dicarbaldehyde chemical structure")
thieno[3,2-b]thiophene-2,5-dicarbaldehyde
Catalog No: FT-0704440
CAS No: 37882-75-0
- Chemical Name: thieno[3,2-b]thiophene-2,5-dicarbaldehyde
- Molecular Formula: C8H4O2S2
- Molecular Weight: 196.3
- InChI Key: UBKNFAFBINVTOP-UHFFFAOYSA-N
- InChI: InChI=1S/C8H4O2S2/c9-3-5-1-7-8(11-5)2-6(4-10)12-7/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 37882-75-0 |
|---|---|
| MF: | C8H4O2S2 |
| Density: | 1.559g/cm3 |
| Flash_Point: | 188.5ºC |
| Melting_Point: | N/A |
| Product_Name: | Thieno[3,2-b]thiophene-2,5-dicarboxaldehyde |
| Symbol: | GHS07 |
| Bolling_Point: | 388.1ºC at 760 mmHg |
| FW: | 196.24600 |
| Density: | 1.559g/cm3 |
|---|---|
| MF: | C8H4O2S2 |
| LogP: | 2.58780 |
| Exact_Mass: | 195.96500 |
| Bolling_Point: | 388.1ºC at 760 mmHg |
| Flash_Point: | 188.5ºC |
| FW: | 196.24600 |
| Refractive_Index: | 1.811 |
| PSA: | 90.62000 |
| Safety_Statements: | H315-H317-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
