Nudifloric Acid
Catalog No: FT-0673168
CAS No: 3719-45-7
- Chemical Name: Nudifloric Acid
- Molecular Formula: C7H7NO3
- Molecular Weight: 153.14
- InChI Key: RGZCKPXTNJAWMR-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7NO3/c1-8-4-5(7(10)11)2-3-6(8)9/h2-4H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3719-45-7 |
| Flash_Point: | 153.2ºC |
| Product_Name: | 1-Methyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid |
| Bolling_Point: | 329.6ºC at 760mmHg |
| FW: | 153.13500 |
| Melting_Point: | N/A |
| MF: | C7H7NO3 |
| Density: | 1.381g/cm3 |
| Refractive_Index: | 1.577 |
|---|---|
| MF: | C7H7NO3 |
| Flash_Point: | 153.2ºC |
| LogP: | 0.08350 |
| FW: | 153.13500 |
| Density: | 1.381g/cm3 |
| PSA: | 59.30000 |
| Bolling_Point: | 329.6ºC at 760mmHg |
| Exact_Mass: | 153.04300 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)