a-Zearalenol
Catalog No: FT-0675897
CAS No: 36455-72-8
- Chemical Name: a-Zearalenol
- Molecular Formula: C18H24O5
- Molecular Weight: 320.4
- InChI Key: FPQFYIAXQDXNOR-QDKLYSGJSA-N
- InChI: InChI=1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 320.380 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 36455-72-8 |
| Bolling_Point: | 599.0±50.0 °C at 760 mmHg |
| Product_Name: | α-Zearalenol |
| Melting_Point: | N/A |
| Flash_Point: | 217.9±23.6 °C |
| MF: | C18H24O5 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 4.17 |
| Flash_Point: | 217.9±23.6 °C |
| Refractive_Index: | 1.549 |
| FW: | 320.380 |
| PSA: | 86.99000 |
| MF: | C18H24O5 |
| Bolling_Point: | 599.0±50.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| Exact_Mass: | 320.162384 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|---|
| Hazard_Codes: | Xn |
| Warning_Statement: | P201-P260-P280-P301 + P312 + P330-P305 + P351 + P338-P308 + P313 |
| Safety_Statements: | H302-H315-H319-H336-H340-H350-H361fd-H371-H373-H412 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)