![2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline (CAS: 361982-79-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0729959.png "2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline chemical structure")
2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline
Catalog No: FT-0729959
CAS No: 361982-79-8
- Chemical Name: 2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline
- Molecular Formula: C13H12ClN
- Molecular Weight: 217.69
- InChI Key: PPGREYUBXFOZBC-UHFFFAOYSA-N
- InChI: InChI=1S/C13H12ClN/c1-8-5-13(14)15-12-7-10-4-2-3-9(10)6-11(8)12/h5-7H,2-4H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 361982-79-8 |
|---|---|
| MF: | C13H12ClN |
| Density: | 1.25g/cm3 |
| Flash_Point: | 206.2ºC |
| Melting_Point: | N/A |
| Product_Name: | 2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline |
| Symbol: | GHS07 |
| Bolling_Point: | 365.2ºC at 760 mmHg |
| FW: | 217.69400 |
| Density: | 1.25g/cm3 |
|---|---|
| MF: | C13H12ClN |
| LogP: | 3.68530 |
| Exact_Mass: | 217.06600 |
| Bolling_Point: | 365.2ºC at 760 mmHg |
| Flash_Point: | 206.2ºC |
| FW: | 217.69400 |
| Refractive_Index: | 1.657 |
| PSA: | 12.89000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
