![6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride (CAS: 36067-72-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0714343.png "6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride chemical structure")
6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride
Catalog No: FT-0714343
CAS No: 36067-72-8
- Chemical Name: 6-ethyl-4,5,7,8-tetrahydro-[1,3]oxazolo[4,5-d]azepin-2-amine;dihydrochloride
- Molecular Formula: C9H17Cl2N3O
- Molecular Weight: 254.15
- InChI Key: HBLPYIOKPJVFQW-UHFFFAOYSA-N
- InChI: InChI=1S/C9H15N3O.2ClH/c1-2-12-5-3-7-8(4-6-12)13-9(10)11-7;;/h2-6H2,1H3,(H2,10,11);2*1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 330.9ºC at 760mmHg |
|---|---|
| CAS: | 36067-72-8 |
| MF: | C9H17Cl2N3O |
| Density: | 1.126g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | B-HT 933 dihydrochloride |
| Flash_Point: | 153.9ºC |
| FW: | 254.15700 |
| Density: | 1.126g/cm3 |
|---|---|
| MF: | C9H17Cl2N3O |
| LogP: | 2.80040 |
| Exact_Mass: | 253.07500 |
| Bolling_Point: | 330.9ºC at 760mmHg |
| Flash_Point: | 153.9ºC |
| FW: | 254.15700 |
| PSA: | 55.29000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| WGK_Germany: | 2 |
| RIDADR: | NONH for all modes of transport |
| RTECS: | RQ5831345 |
