2-(4-bromophenoxy)acetamide
Catalog No: FT-0768478
CAS No: 35368-75-3
- Chemical Name: 2-(4-bromophenoxy)acetamide
- Molecular Formula: C8H8BrNO2
- Molecular Weight: 230.06
- InChI Key: IFFIYLGFSQQYFB-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8BrNO2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H2,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 35368-75-3 |
| Flash_Point: | 193.6ºC |
| Product_Name: | 2-(4-Bromophenoxy)acetamide |
| Bolling_Point: | 396.6ºC at 760 mmHg |
| FW: | 230.05900 |
| Melting_Point: | N/A |
| MF: | C8H8BrNO2 |
| Density: | 1.565g/cm3 |
| FW: | 230.05900 |
|---|---|
| Refractive_Index: | 1.578 |
| MF: | C8H8BrNO2 |
| Exact_Mass: | 228.97400 |
| LogP: | 2.01350 |
| Bolling_Point: | 396.6ºC at 760 mmHg |
| Density: | 1.565g/cm3 |
| PSA: | 52.32000 |
| Flash_Point: | 193.6ºC |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2924299090 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)