![[2,2']BITHIOPHENYL-5-YL-METHANOL (CAS: 3515-30-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0605403.png "[2,2']BITHIOPHENYL-5-YL-METHANOL chemical structure")
[2,2']BITHIOPHENYL-5-YL-METHANOL
Catalog No: FT-0605403
CAS No: 3515-30-8
- Chemical Name: [2,2']BITHIOPHENYL-5-YL-METHANOL
- Molecular Formula: C9H8OS2
- Molecular Weight: 196.3
- InChI Key: PUWTXRUXHPHFSQ-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8OS2/c10-6-7-3-4-9(12-7)8-2-1-5-11-8/h1-5,10H,6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-(Hydroxymethyl)-[2,2']-bithiophene |
|---|---|
| Flash_Point: | 151.7±25.1 °C |
| Melting_Point: | 51ºC |
| FW: | 196.289 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 3515-30-8 |
| Bolling_Point: | 327.2±32.0 °C at 760 mmHg |
| MF: | C9H8OS2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 2.40 |
| Flash_Point: | 151.7±25.1 °C |
| Melting_Point: | 51ºC |
| FW: | 196.289 |
| PSA: | 76.71000 |
| Exact_Mass: | 196.001648 |
| MF: | C9H8OS2 |
| Bolling_Point: | 327.2±32.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.654 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2934999090 |
| Safety_Statements: | 24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)