5-CHLORO-6-METHOXY-1-INDANONE
Catalog No: FT-0655552
CAS No: 344305-70-0
- Chemical Name: 5-CHLORO-6-METHOXY-1-INDANONE
- Molecular Formula: C10H9ClO2
- Molecular Weight: 196.63
- InChI Key: XIUZEIYKEBEXIB-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9ClO2/c1-13-10-5-7-6(4-8(10)11)2-3-9(7)12/h4-5H,2-3H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 196.630 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 344305-70-0 |
| Bolling_Point: | 340.6±42.0 °C at 760 mmHg |
| Product_Name: | 5-Chloro-6-methoxy-1-indanone |
| Melting_Point: | N/A |
| Flash_Point: | 154.2±26.9 °C |
| MF: | C10H9ClO2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 2.91 |
| Flash_Point: | 154.2±26.9 °C |
| Refractive_Index: | 1.578 |
| FW: | 196.630 |
| PSA: | 26.30000 |
| MF: | C10H9ClO2 |
| Bolling_Point: | 340.6±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 196.029114 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | 22-43 |
| Safety_Statements: | 37/39 |
| Symbol: | Warning |
| Warning_Statement: | P280 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2914700090 |
Related Products
N-Acetyl-S-(3,4-dihydroxybutyl)-L-cysteine (Mixture of Diastereomers)
o-2,3,4,6-Tetra-o-acetyl-A-D-mannopyranosyl-(1-3)-o-[2,3,4,6-tetra-o-acetyl-A-D-mannopyranosyl-(1-6)]-1,2-o-ethylidene--D-mannopyranose acetate
D,L-N-Acetyl-3-(3,4-dimethoxyphenyl)-2-methyl-alanine Ethyl Ester
2-(4'-Acetyl-2-fluoro-biphenyl-4-yl)-propionic Acid Methyl Ester