2-(2-Pyridyl)-4-methylthiazole-5-carboxylic acid
Catalog No: FT-0678828
CAS No: 34418-48-9
- Chemical Name: 2-(2-Pyridyl)-4-methylthiazole-5-carboxylic acid
- Molecular Formula: C10H8N2O2S
- Molecular Weight: 220.25
- InChI Key: QFDHWPOPCNNAOI-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8N2O2S/c1-6-8(10(13)14)15-9(12-6)7-4-2-3-5-11-7/h2-5H,1H3,(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| Bolling_Point: | 457.3±53.0 °C at 760 mmHg |
| MF: | C10H8N2O2S |
| Symbol: | GHS07 |
| Melting_Point: | 221-226ºC (D) |
| CAS: | 34418-48-9 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 220.248 |
| Flash_Point: | 230.4±30.9 °C |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
|---|---|
| Exact_Mass: | 220.030655 |
| Refractive_Index: | 1.636 |
| LogP: | 2.30 |
| Bolling_Point: | 457.3±53.0 °C at 760 mmHg |
| Density: | 1.4±0.1 g/cm3 |
| MF: | C10H8N2O2S |
| PSA: | 91.32000 |
| FW: | 220.248 |
| Flash_Point: | 230.4±30.9 °C |
| Melting_Point: | 221-226ºC (D) |
| Risk_Statements(EU): | 36 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H319 |
| HS_Code: | 2934100090 |
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Hazard_Codes: | Xi: Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)