Methyl 5-chloropyrazine-2-carboxylate
Catalog No: FT-0648272
CAS No: 33332-25-1
- Chemical Name: Methyl 5-chloropyrazine-2-carboxylate
- Molecular Formula: C6H5ClN2O2
- Molecular Weight: 172.57
- InChI Key: CVVMLRFXZPKILB-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5ClN2O2/c1-11-6(10)4-2-9-5(7)3-8-4/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 172.569 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 33332-25-1 |
| Bolling_Point: | 242.8±35.0 °C at 760 mmHg |
| Product_Name: | Methyl 5-chloropyrazine-2-carboxylate |
| Melting_Point: | N/A |
| Flash_Point: | 100.6±25.9 °C |
| MF: | C6H5ClN2O2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 0.57 |
| Flash_Point: | 100.6±25.9 °C |
| Refractive_Index: | 1.534 |
| FW: | 172.569 |
| PSA: | 52.08000 |
| MF: | C6H5ClN2O2 |
| Bolling_Point: | 242.8±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 172.003952 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)