4,6-Dichloro-2-(methylthio)-5-formylpyrimidine
Catalog No: FT-0666590
CAS No: 33097-11-9
- Chemical Name: 4,6-Dichloro-2-(methylthio)-5-formylpyrimidine
- Molecular Formula: C6H4Cl2N2OS
- Molecular Weight: 223.08
- InChI Key: MRHGOAKYYORQGQ-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4Cl2N2OS/c1-12-6-9-4(7)3(2-11)5(8)10-6/h2H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 223.080 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 33097-11-9 |
| Bolling_Point: | 327.7±37.0 °C at 760 mmHg |
| Product_Name: | 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbaldehyde |
| Melting_Point: | 82-84ºC |
| Flash_Point: | 152.0±26.5 °C |
| MF: | C6H4Cl2N2OS |
| LogP: | 2.78 |
|---|---|
| Flash_Point: | 152.0±26.5 °C |
| Refractive_Index: | 1.617 |
| FW: | 223.080 |
| Bolling_Point: | 327.7±37.0 °C at 760 mmHg |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | 82-84ºC |
| PSA: | 68.15000 |
| Exact_Mass: | 221.942139 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C6H4Cl2N2OS |
| Warning_Statement: | P280 |
|---|---|
| Safety_Statements: | H302-H317 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)