1,2-DIHYDRO-5-(3-PYRIDINYL)-3H-1,2,4-TRIAZOLE-3-THIONE
Catalog No: FT-0606408
CAS No: 32362-88-2
- Chemical Name: 1,2-DIHYDRO-5-(3-PYRIDINYL)-3H-1,2,4-TRIAZOLE-3-THIONE
- Molecular Formula: C7H6N4S
- Molecular Weight: 178.22
- InChI Key: GAYWCADKXYCKCG-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N4S/c12-7-9-6(10-11-7)5-2-1-3-8-4-5/h1-4H,(H2,9,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 178.21400 |
| Density: | 1.54g/cm3 |
| CAS: | 32362-88-2 |
| Bolling_Point: | 296.5ºC at 760mmHg |
| Product_Name: | 1,2-dihydro-5-(3-pyridinyl)-3h-1,2,4-triazole-3-thione |
| Melting_Point: | 296-302ºC |
| Flash_Point: | 133.1ºC |
| MF: | C7H6N4S |
| Density: | 1.54g/cm3 |
|---|---|
| LogP: | 1.52930 |
| Flash_Point: | 133.1ºC |
| Melting_Point: | 296-302ºC |
| FW: | 178.21400 |
| PSA: | 89.45000 |
| Exact_Mass: | 178.03100 |
| MF: | C7H6N4S |
| Bolling_Point: | 296.5ºC at 760mmHg |
| Refractive_Index: | 1.795 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)