3-Bromo-4-hydroxy-5-nitropyridine
Catalog No: FT-0660703
CAS No: 31872-65-8
- Chemical Name: 3-Bromo-4-hydroxy-5-nitropyridine
- Molecular Formula: C5H3BrN2O3
- Molecular Weight: 218.99
- InChI Key: IIIJPRRVYYWKQW-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3BrN2O3/c6-3-1-7-2-4(5(3)9)8(10)11/h1-2H,(H,7,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 218.993 |
| Density: | 2.0±0.1 g/cm3 |
| CAS: | 31872-65-8 |
| Bolling_Point: | 341.8±37.0 °C at 760 mmHg |
| Product_Name: | 3-Bromo-5-nitro-4-pyridinol |
| Melting_Point: | N/A |
| Flash_Point: | 160.5±26.5 °C |
| MF: | C5H3BrN2O3 |
| Density: | 2.0±0.1 g/cm3 |
|---|---|
| LogP: | 0.08 |
| Flash_Point: | 160.5±26.5 °C |
| Refractive_Index: | 1.664 |
| FW: | 218.993 |
| PSA: | 78.94000 |
| MF: | C5H3BrN2O3 |
| Bolling_Point: | 341.8±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 217.932693 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)