1,3-Dipropyl-7-methylxanthine
Catalog No: FT-0606723
CAS No: 31542-63-9
- Chemical Name: 1,3-Dipropyl-7-methylxanthine
- Molecular Formula: C12H18N4O2
- Molecular Weight: 250.3
- InChI Key: QVAYTZAGDQIWMB-UHFFFAOYSA-N
- InChI: InChI=1S/C12H18N4O2/c1-4-6-15-10-9(14(3)8-13-10)11(17)16(7-5-2)12(15)18/h8H,4-7H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 114-117ºC |
|---|---|
| CAS: | 31542-63-9 |
| MF: | C12H18N4O2 |
| Flash_Point: | 222.0±26.5 °C |
| Product_Name: | 7-methyl-1,3-dipropylpurine-2,6-dione |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 250.297 |
| Bolling_Point: | 443.5±37.0 °C at 760 mmHg |
| Refractive_Index: | 1.612 |
|---|---|
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Flash_Point: | 222.0±26.5 °C |
| LogP: | 1.99 |
| Bolling_Point: | 443.5±37.0 °C at 760 mmHg |
| FW: | 250.297 |
| PSA: | 61.82000 |
| Melting_Point: | 114-117ºC |
| MF: | C12H18N4O2 |
| Exact_Mass: | 250.142975 |
| Density: | 1.3±0.1 g/cm3 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2933990090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)