Pyrimidine-2-carboxylic acid
Catalog No: FT-0600426
CAS No: 31519-62-7
- Chemical Name: Pyrimidine-2-carboxylic acid
- Molecular Formula: C5H4N2O2
- Molecular Weight: 124.1
- InChI Key: ZFCHNZDUMIOWFV-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4N2O2/c8-5(9)4-6-2-1-3-7-4/h1-3H,(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 124.098 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 31519-62-7 |
| Bolling_Point: | 362.6±25.0 °C at 760 mmHg |
| Product_Name: | 4-Pyrimidinecarboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | 173.1±23.2 °C |
| MF: | C5H4N2O2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | -0.81 |
| Flash_Point: | 173.1±23.2 °C |
| Refractive_Index: | 1.579 |
| FW: | 124.098 |
| PSA: | 63.08000 |
| MF: | C5H4N2O2 |
| Bolling_Point: | 362.6±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Exact_Mass: | 124.027275 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)