4-(2-THIENYL)BENZOIC ACID
Catalog No: FT-0616565
CAS No: 29886-62-2
- Chemical Name: 4-(2-THIENYL)BENZOIC ACID
- Molecular Formula: C11H8O2S
- Molecular Weight: 204.25
- InChI Key: CVDUBQJEQNRCIZ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8O2S/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h1-7H,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 29886-62-2 |
| Flash_Point: | 179.3±23.2 °C |
| Product_Name: | 4-(Thiophen-2-yl)benzoic acid |
| Bolling_Point: | 372.8±25.0 °C at 760 mmHg |
| FW: | 204.245 |
| Melting_Point: | 240ºC |
| MF: | C11H8O2S |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 240ºC |
|---|---|
| Refractive_Index: | 1.636 |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| MF: | C11H8O2S |
| Flash_Point: | 179.3±23.2 °C |
| LogP: | 3.56 |
| FW: | 204.245 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 65.54000 |
| Bolling_Point: | 372.8±25.0 °C at 760 mmHg |
| Exact_Mass: | 204.024506 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| HS_Code: | 2934999090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant;Xn: Harmful; |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)