5-Methoxynicotinonitrile
Catalog No: FT-0678836
CAS No: 298204-74-7
- Chemical Name: 5-Methoxynicotinonitrile
- Molecular Formula: C7H6N2O
- Molecular Weight: 134.14
- InChI Key: DMLPQTWDFZCDTJ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N2O/c1-10-7-2-6(3-8)4-9-5-7/h2,4-5H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 134.13500 |
| Density: | 1.16g/cm3 |
| CAS: | 298204-74-7 |
| Bolling_Point: | 238.6ºC at 760 mmHg |
| Product_Name: | 5-Methoxynicotinonitrile |
| Melting_Point: | N/A |
| Flash_Point: | 98.1ºC |
| MF: | C7H6N2O |
| Density: | 1.16g/cm3 |
|---|---|
| LogP: | 0.96188 |
| Flash_Point: | 98.1ºC |
| Refractive_Index: | 1.526 |
| FW: | 134.13500 |
| PSA: | 45.91000 |
| MF: | C7H6N2O |
| Bolling_Point: | 238.6ºC at 760 mmHg |
| Vapor_Pressure: | 0.042mmHg at 25°C |
| Exact_Mass: | 134.04800 |
| Warning_Statement: | P301 + P310 |
|---|---|
| Safety_Statements: | H301 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)