3-aminoazepan-2-one;hydrochloride
Catalog No: FT-0746905
CAS No: 29426-64-0
- Chemical Name: 3-aminoazepan-2-one;hydrochloride
- Molecular Formula: C6H13ClN2O
- Molecular Weight: 164.63
- InChI Key: LWXJCGXAYXXXRU-UHFFFAOYSA-N
- InChI: InChI=1S/C6H12N2O.ClH/c7-5-3-1-2-4-8-6(5)9;/h5H,1-4,7H2,(H,8,9);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 29426-64-0 |
|---|---|
| MF: | C6H13ClN2O |
| Density: | N/A |
| Flash_Point: | 159.6ºC |
| Melting_Point: | N/A |
| Product_Name: | 3-aminoazepan-2-one,hydrochloride |
| Symbol: | GHS07 |
| Bolling_Point: | 340.3ºC at 760 mmHg |
| FW: | 164.633 |
| Bolling_Point: | 340.3ºC at 760 mmHg |
|---|---|
| MF: | C6H13ClN2O |
| LogP: | 1.39200 |
| Exact_Mass: | 164.071640 |
| Vapor_Pressure: | 6.17E-05mmHg at 25°C |
| Flash_Point: | 159.6ºC |
| FW: | 164.633 |
| PSA: | 58.61000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | 26 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful; |
| HS_Code: | 2933790090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | 22-36/37/38 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)