2-BROMO-3,4,5,6-TETRAFLUOROBENZYLALCOHOL
Catalog No: FT-0611409
CAS No: 292621-47-7
- Chemical Name: 2-BROMO-3,4,5,6-TETRAFLUOROBENZYLALCOHOL
- Molecular Formula: C7H3BrF4O
- Molecular Weight: 259
- InChI Key: ZFUAHFYDXOLWST-UHFFFAOYSA-N
- InChI: InChI=1S/C7H3BrF4O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h13H,1H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (2-bromo-3,4,5,6-tetrafluorophenyl)methanol |
|---|---|
| Flash_Point: | 94.4ºC |
| Melting_Point: | N/A |
| FW: | 258.99600 |
| Density: | 1.9 g/cm3 |
| CAS: | 292621-47-7 |
| Bolling_Point: | 232.5ºC at 760 mmHg |
| MF: | C7H3BrF4O |
| Density: | 1.9 g/cm3 |
|---|---|
| LogP: | 2.49780 |
| Flash_Point: | 94.4ºC |
| FW: | 258.99600 |
| PSA: | 20.23000 |
| MF: | C7H3BrF4O |
| Bolling_Point: | 232.5ºC at 760 mmHg |
| Exact_Mass: | 257.93000 |
| HS_Code: | 2906299090 |
|---|