2-Heptadecanone
Catalog No: FT-0669117
CAS No: 2922-51-2
- Chemical Name: 2-Heptadecanone
- Molecular Formula: C17H34O
- Molecular Weight: 254.5
- InChI Key: TVTCXPXLRKTHAU-UHFFFAOYSA-N
- InChI: InChI=1S/C17H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18/h3-16H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 47-50ºC |
|---|---|
| CAS: | 2922-51-2 |
| MF: | C17H34O |
| Flash_Point: | 80.6ºC |
| Product_Name: | Heptadecan-2-one |
| Density: | 0.83g/cm3 |
| FW: | 254.45100 |
| Bolling_Point: | 319.9ºC at 760mmHg |
| Refractive_Index: | 1.44 |
|---|---|
| Vapor_Pressure: | 0.000617mmHg at 25°C |
| Flash_Point: | 80.6ºC |
| LogP: | 6.05670 |
| Bolling_Point: | 319.9ºC at 760mmHg |
| FW: | 254.45100 |
| PSA: | 17.07000 |
| Melting_Point: | 47-50ºC |
| MF: | C17H34O |
| Exact_Mass: | 254.26100 |
| Density: | 0.83g/cm3 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Safety_Statements: | S22-S24/25 |
| HS_Code: | 2914190090 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)