1-FORMYLINDOLINE
Catalog No: FT-0607794
CAS No: 2861-59-8
- Chemical Name: 1-FORMYLINDOLINE
- Molecular Formula: C9H9NO
- Molecular Weight: 147.17
- InChI Key: DGCIPHNRGLERLO-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9NO/c11-7-10-6-5-8-3-1-2-4-9(8)10/h1-4,7H,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,3-dihydroindole-1-carbaldehyde |
|---|---|
| Flash_Point: | 136.5ºC |
| Melting_Point: | 63-65ºC |
| FW: | 147.17400 |
| Density: | 1.266g/cm3 |
| CAS: | 2861-59-8 |
| Bolling_Point: | 165ºC 8mm |
| MF: | C9H9NO |
| Density: | 1.266g/cm3 |
|---|---|
| LogP: | 1.90640 |
| Flash_Point: | 136.5ºC |
| Melting_Point: | 63-65ºC |
| FW: | 147.17400 |
| PSA: | 20.31000 |
| Exact_Mass: | 147.06800 |
| MF: | C9H9NO |
| Bolling_Point: | 165ºC 8mm |
| Vapor_Pressure: | 0.00212mmHg at 25°C |
| Refractive_Index: | 1.681 |
| HS_Code: | 2933990090 |
|---|---|
| Safety_Statements: | 22-24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)