3,4-DIHYDRO-2H-1,5-BENZODIOXEPIN-7-YLBORONIC ACID
Catalog No: FT-0614306
CAS No: 279261-89-1
- Chemical Name: 3,4-DIHYDRO-2H-1,5-BENZODIOXEPIN-7-YLBORONIC ACID
- Molecular Formula: C9H11BO4
- Molecular Weight: 193.99
- InChI Key: CSNCBPVLUIFJOS-UHFFFAOYSA-N
- InChI: InChI=1S/C9H11BO4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6,11-12H,1,4-5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3,4-Dihydro-2H-1,5-benzodioxepin-7-ylboronic acid |
|---|---|
| Flash_Point: | 178.2ºC |
| Melting_Point: | 150ºC |
| FW: | 193.99200 |
| Density: | 1.29g/cm3 |
| CAS: | 279261-89-1 |
| Bolling_Point: | 371ºC at 760mmHg |
| MF: | C9H11BO4 |
| Density: | 1.29g/cm3 |
|---|---|
| Flash_Point: | 178.2ºC |
| Melting_Point: | 150ºC |
| FW: | 193.99200 |
| PSA: | 58.92000 |
| Exact_Mass: | 194.07500 |
| MF: | C9H11BO4 |
| Bolling_Point: | 371ºC at 760mmHg |
| Vapor_Pressure: | 3.69E-06mmHg at 25°C |
| Refractive_Index: | 1.563 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2932999099 |
| Safety_Statements: | 26-37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)