2-AMINOACRIDONE
Catalog No: FT-0611223
CAS No: 27918-14-5
- Chemical Name: 2-AMINOACRIDONE
- Molecular Formula: C13H10N2O
- Molecular Weight: 210.23
- InChI Key: PIGCSKVALLVWKU-UHFFFAOYSA-N
- InChI: InChI=1S/C13H10N2O/c14-8-5-6-12-10(7-8)13(16)9-3-1-2-4-11(9)15-12/h1-7H,14H2,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 210.231 |
|---|---|
| CAS: | 27918-14-5 |
| Flash_Point: | 221.4±25.7 °C |
| MF: | C13H10N2O |
| Symbol: | Warning |
| Bolling_Point: | 442.5±34.0 °C at 760 mmHg |
| Melting_Point: | N/A |
| Product_Name: | 2-Aminoacridone |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 210.231 |
|---|---|
| MF: | C13H10N2O |
| Exact_Mass: | 210.079315 |
| Bolling_Point: | 442.5±34.0 °C at 760 mmHg |
| Refractive_Index: | 1.690 |
| PSA: | 58.88000 |
| LogP: | 1.54 |
| Flash_Point: | 221.4±25.7 °C |
| Density: | 1.3±0.1 g/cm3 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)