4-(P-IODOPHENYL)BUTYRIC ACID
Catalog No: FT-0638731
CAS No: 27913-58-2
- Molecular Formula: 290.1
- Formula Weight: C10H11IO2
- Inchl Key: OGOMLUBUDYFIOG-UHFFFAOYSA-N
- Inchl: InChI=1S/C10H11IO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-(4-iodophenyl)butanoic acid |
|---|---|
| Flash_Point: | 166.1ºC |
| Melting_Point: | N/A |
| FW: | 290.09800 |
| Density: | 1.686g/cm3 |
| CAS: | 27913-58-2 |
| Bolling_Point: | 351ºC at 760 mmHg |
| MF: | C10H11IO2 |
| Density: | 1.686g/cm3 |
|---|---|
| LogP: | 2.69850 |
| Flash_Point: | 166.1ºC |
| Refractive_Index: | 1.608 |
| FW: | 290.09800 |
| PSA: | 37.30000 |
| MF: | C10H11IO2 |
| Bolling_Point: | 351ºC at 760 mmHg |
| Vapor_Pressure: | 1.58E-05mmHg at 25°C |
| Exact_Mass: | 289.98000 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2916399090 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)