![2-methyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one (CAS: 27433-55-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0715530.png "2-methyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one chemical structure")
2-methyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one
Catalog No: FT-0715530
CAS No: 27433-55-2
- Chemical Name: 2-methyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one
- Molecular Formula: C6H5N3O2
- Molecular Weight: 151.12
- InChI Key: VHNKDSNYFRHJMK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5N3O2/c1-3-9-4-5(10)7-2-8-6(4)11-3/h2H,1H3,(H,7,8,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 27433-55-2 |
|---|---|
| MF: | C6H5N3O2 |
| Density: | 1.69g/cm3 |
| Flash_Point: | 189.8ºC |
| Melting_Point: | N/A |
| Product_Name: | 2-methyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one |
| Symbol: | GHS07 |
| Bolling_Point: | 390.2ºC at 760mmHg |
| FW: | 151.12300 |
| Bolling_Point: | 390.2ºC at 760mmHg |
|---|---|
| Density: | 1.69g/cm3 |
| MF: | C6H5N3O2 |
| LogP: | 0.21950 |
| Exact_Mass: | 151.03800 |
| Vapor_Pressure: | 2.7E-06mmHg at 25°C |
| Flash_Point: | 189.8ºC |
| FW: | 151.12300 |
| Refractive_Index: | 1.751 |
| PSA: | 71.78000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
![tert-butyl 2,9-diazaspiro[6.6]tridecane-2-carboxylate (CAS: 1160246-81-0) - Related Chemical Product](/static/img/prod_pic/FT-0725561.png "tert-butyl 2,9-diazaspiro[6.6]tridecane-2-carboxylate chemical structure")
