(2,6-diamino-5-thiocyanatopyridin-3-yl) thiocyanate
Catalog No: FT-0707844
CAS No: 2645-32-1
- Chemical Name: (2,6-diamino-5-thiocyanatopyridin-3-yl) thiocyanate
- Molecular Formula: C7H5N5S2
- Molecular Weight: 223.3
- InChI Key: ZXOBLNBVNROVLC-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5N5S2/c8-2-13-4-1-5(14-3-9)7(11)12-6(4)10/h1H,(H4,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 2645-32-1 |
|---|---|
| MF: | C7H5N5S2 |
| Density: | 1.6±0.1 g/cm3 |
| Flash_Point: | 199.3±28.7 °C |
| Melting_Point: | N/A |
| Product_Name: | PR-619 |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | 406.0±45.0 °C at 760 mmHg |
| FW: | 223.278 |
| Bolling_Point: | 406.0±45.0 °C at 760 mmHg |
|---|---|
| Density: | 1.6±0.1 g/cm3 |
| MF: | C7H5N5S2 |
| LogP: | 2.05 |
| Exact_Mass: | 222.998642 |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 199.3±28.7 °C |
| FW: | 223.278 |
| Refractive_Index: | 1.764 |
| PSA: | 163.84000 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Safety_Statements: | H302-H315-H317-H318-H335 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)