3-(BROMOMETHYL)PYRENE
Catalog No: FT-0613726
CAS No: 2595-90-6
- Chemical Name: 3-(BROMOMETHYL)PYRENE
- Molecular Formula: C17H11Br
- Molecular Weight: 295.2
- InChI Key: UGMXRPVWWWDPFC-UHFFFAOYSA-N
- InChI: InChI=1S/C17H11Br/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-9H,10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 295.17300 |
| Density: | 1.541g/cm3 |
| CAS: | 2595-90-6 |
| Bolling_Point: | 443.3ºC at 760mmHg |
| Product_Name: | 1-(Bromomethyl)pyrene |
| Melting_Point: | 145-147ºC |
| Flash_Point: | 225.5ºC |
| MF: | C17H11Br |
| Density: | 1.541g/cm3 |
|---|---|
| LogP: | 5.47890 |
| Flash_Point: | 225.5ºC |
| Melting_Point: | 145-147ºC |
| FW: | 295.17300 |
| Exact_Mass: | 294.00400 |
| MF: | C17H11Br |
| Bolling_Point: | 443.3ºC at 760mmHg |
| Vapor_Pressure: | 1.22E-07mmHg at 25°C |
| Refractive_Index: | 1.844 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H315-H318-H335 |
| Symbol: | Danger |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)