![2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetic acid (CAS: 23576-42-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0774071.png "2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetic acid chemical structure")
2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetic acid
Catalog No: FT-0774071
CAS No: 23576-42-3
- Chemical Name: 2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetic acid
- Molecular Formula: C13H17N3O4
- Molecular Weight: 279.29
- InChI Key: NAXPHWZXEXNDIW-JTQLQIEISA-N
- InChI: InChI=1S/C13H17N3O4/c14-10(6-9-4-2-1-3-5-9)13(20)16-7-11(17)15-8-12(18)19/h1-5,10H,6-8,14H2,(H,15,17)(H,16,20)(H,18,19)/t10-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 279.29200 |
| CAS: | 23576-42-3 |
| MF: | C13H17N3O4 |
| Flash_Point: | 357.4ºC |
| Product_Name: | Phe-Gly-Gly |
| Bolling_Point: | 667.3ºC at 760 mmHg |
| Density: | 1.296 g/cm3 |
| FW: | 279.29200 |
|---|---|
| Refractive_Index: | 1.576 |
| Vapor_Pressure: | 1.02E-18mmHg at 25°C |
| MF: | C13H17N3O4 |
| Exact_Mass: | 279.12200 |
| LogP: | 0.35550 |
| Bolling_Point: | 667.3ºC at 760 mmHg |
| Density: | 1.296 g/cm3 |
| PSA: | 121.52000 |
| Flash_Point: | 357.4ºC |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2924299090 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
