(3-Butoxyphenyl)amine
Catalog No: FT-0683458
CAS No: 23079-68-7
- Chemical Name: (3-Butoxyphenyl)amine
- Molecular Formula: C10H15NO
- Molecular Weight: 165.23
- InChI Key: ZIZHOYOBASUITD-UHFFFAOYSA-N
- InChI: InChI=1S/C10H15NO/c1-2-3-7-12-10-6-4-5-9(11)8-10/h4-6,8H,2-3,7,11H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 165.23200 |
| Density: | 1g/cm3 |
| CAS: | 23079-68-7 |
| Bolling_Point: | 282.785ºC at 760 mmHg |
| Product_Name: | (3-Butoxyphenyl)amine |
| Melting_Point: | N/A |
| Flash_Point: | 127.453ºC |
| MF: | C10H15NO |
| Density: | 1g/cm3 |
|---|---|
| LogP: | 3.02890 |
| Flash_Point: | 127.453ºC |
| Refractive_Index: | 1.53 |
| FW: | 165.23200 |
| PSA: | 35.25000 |
| MF: | C10H15NO |
| Bolling_Point: | 282.785ºC at 760 mmHg |
| Vapor_Pressure: | 0.003mmHg at 25°C |
| Exact_Mass: | 165.11500 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2922299090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)