1,1-Bis-(4-bromophenyl)-2,2-dichloroethylene
Catalog No: FT-0606062
CAS No: 21655-73-2
- Chemical Name: 1,1-Bis-(4-bromophenyl)-2,2-dichloroethylene
- Molecular Formula: C14H8Br2Cl2
- Molecular Weight: 406.9
- InChI Key: XYMOLSVHRUAQPB-UHFFFAOYSA-N
- InChI: InChI=1S/C14H8Br2Cl2/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 414ºC at 760 mmHg |
|---|---|
| MF: | C14H8Br2Cl2 |
| Density: | 1.729g/cm3 |
| FW: | 406.92700 |
| Product_Name: | 1-bromo-4-[1-(4-bromophenyl)-2,2-dichloroethenyl]benzene |
| CAS: | 21655-73-2 |
| Flash_Point: | 236ºC |
| Melting_Point: | N/A |
| Bolling_Point: | 414ºC at 760 mmHg |
|---|---|
| MF: | C14H8Br2Cl2 |
| Density: | 1.729g/cm3 |
| Refractive_Index: | 1.646 |
| Exact_Mass: | 403.83700 |
| LogP: | 6.40610 |
| Flash_Point: | 236ºC |
| Vapor_Pressure: | 1.11E-06mmHg at 25°C |
| FW: | 406.92700 |
| HS_Code: | 2903999090 |
|---|