![[2-(aminomethyl)phenyl]methanamine;dihydrochloride (CAS: 21294-14-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0707850.png "[2-(aminomethyl)phenyl]methanamine;dihydrochloride chemical structure")
[2-(aminomethyl)phenyl]methanamine;dihydrochloride
Catalog No: FT-0707850
CAS No: 21294-14-4
- Chemical Name: [2-(aminomethyl)phenyl]methanamine;dihydrochloride
- Molecular Formula: C8H14Cl2N2
- Molecular Weight: 209.11
- InChI Key: VDEOIFDDSWXYDA-UHFFFAOYSA-N
- InChI: InChI=1S/C8H12N2.2ClH/c9-5-7-3-1-2-4-8(7)6-10;;/h1-4H,5-6,9-10H2;2*1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 21294-14-4 |
|---|---|
| MF: | C8H14Cl2N2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 1,2-Phenylenedimethanaminium Dichloride |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 209.116 |
| Exact_Mass: | 208.053406 |
|---|---|
| MF: | C8H14Cl2N2 |
| LogP: | 3.60860 |
| PSA: | 52.04000 |
| FW: | 209.116 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2921590090 |
| RIDADR: | NONH for all modes of transport |
