4-(4-chlorophenoxy)benzoic acid
Catalog No: FT-0734656
CAS No: 21120-67-2
- Chemical Name: 4-(4-chlorophenoxy)benzoic acid
- Molecular Formula: C13H9ClO3
- Molecular Weight: 248.66
- InChI Key: YVVCMTFJWOYNJW-UHFFFAOYSA-N
- InChI: InChI=1S/C13H9ClO3/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h1-8H,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 248.66200 |
|---|---|
| CAS: | 21120-67-2 |
| Flash_Point: | 191.1ºC |
| MF: | C13H9ClO3 |
| Symbol: | Warning |
| Bolling_Point: | 392.3ºC at 760mmHg |
| Melting_Point: | 167-171ºC |
| Product_Name: | 4-(4-chlorophenoxy)benzoic acid |
| Density: | 1.347g/cm3 |
| FW: | 248.66200 |
|---|---|
| MF: | C13H9ClO3 |
| Exact_Mass: | 248.02400 |
| Bolling_Point: | 392.3ºC at 760mmHg |
| LogP: | 3.83050 |
| Vapor_Pressure: | 7.39E-07mmHg at 25°C |
| PSA: | 46.53000 |
| Refractive_Index: | 1.616 |
| Melting_Point: | 167-171ºC |
| Flash_Point: | 191.1ºC |
| Density: | 1.347g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Symbol: | GHS07, GHS09 |
| Safety_Statements: | 26-36/37-60-61 |
| RIDADR: | UN 3077 9 / PGIII |
| Risk_Statements(EU): | R22 |
| Hazard_Codes: | Xn: Harmful;N: Dangerous for the environment; |
| Warning_Statement: | P273-P280-P305 + P351 + P338 |
| HS_Code: | 2918990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)