THYMINE-1-ACETIC ACID
Catalog No: FT-0660753
CAS No: 20924-05-4
- Chemical Name: THYMINE-1-ACETIC ACID
- Molecular Formula: C7H8N2O4
- Molecular Weight: 184.15
- InChI Key: TZDMCKHDYUDRMB-UHFFFAOYSA-N
- InChI: InChI=1S/C7H8N2O4/c1-4-2-9(3-5(10)11)7(13)8-6(4)12/h2H,3H2,1H3,(H,10,11)(H,8,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 184.149 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 20924-05-4 |
| Bolling_Point: | 424.4ºC at 760 mmHg |
| Product_Name: | Thymine-1-acetic acid |
| Melting_Point: | 272-278ºC (dec.)(lit.) |
| Flash_Point: | 210.5ºC |
| MF: | C7H8N2O4 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | -0.80 |
| Flash_Point: | 210.5ºC |
| Melting_Point: | 272-278ºC (dec.)(lit.) |
| FW: | 184.149 |
| PSA: | 92.16000 |
| Exact_Mass: | 184.048401 |
| MF: | C7H8N2O4 |
| Bolling_Point: | 424.4ºC at 760 mmHg |
| Vapor_Pressure: | 5.57E-09mmHg at 25°C |
| Refractive_Index: | 1.540 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | 36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)