AC-LYS-OME HCL
Catalog No: FT-0638065
CAS No: 20911-93-7
- Chemical Name: AC-LYS-OME HCL
- Molecular Formula: C9H19ClN2O3
- Molecular Weight: 238.71
- InChI Key: PCHGTXYLEAQWOM-QRPNPIFTSA-N
- InChI: InChI=1S/C9H18N2O3.ClH/c1-7(12)11-8(9(13)14-2)5-3-4-6-10;/h8H,3-6,10H2,1-2H3,(H,11,12);1H/t8-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 108-114ºC(lit.) |
|---|---|
| CAS: | 20911-93-7 |
| MF: | C9H19ClN2O3 |
| Flash_Point: | 168.2ºC |
| Product_Name: | Ac-Lys-Ome HCl |
| Density: | N/A |
| FW: | 238.712 |
| Bolling_Point: | 354.6ºC at 760mmHg |
| Vapor_Pressure: | 3.32E-05mmHg at 25°C |
|---|---|
| Flash_Point: | 168.2ºC |
| LogP: | 1.68630 |
| Bolling_Point: | 354.6ºC at 760mmHg |
| PSA: | 81.42000 |
| Melting_Point: | 108-114ºC(lit.) |
| MF: | C9H19ClN2O3 |
| Exact_Mass: | 238.108414 |
| FW: | 238.712 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)Unknow ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)104-108 ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive indexUnknow ', '8. Flash point(ºC)Unknow ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Safety_Statements: | 24/25 |
| WGK_Germany: | 3 |