2-Hydroxy-3-cyanopyridine
Catalog No: FT-0650437
CAS No: 20577-27-9
- Chemical Name: 2-Hydroxy-3-cyanopyridine
- Molecular Formula: C6H4N2O
- Molecular Weight: 120.11
- InChI Key: DYUMBFTYRJMAFK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4N2O/c7-4-5-2-1-3-8-6(5)9/h1-3H,(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 120.109 |
|---|---|
| CAS: | 20577-27-9 |
| Flash_Point: | 166.9±25.9 °C |
| MF: | C6H4N2O |
| Symbol: | Danger |
| Bolling_Point: | 352.3±35.0 °C at 760 mmHg |
| Melting_Point: | 90-94ºC |
| Product_Name: | 2-Hydroxy-3-cyanopyridine |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 120.109 |
|---|---|
| MF: | C6H4N2O |
| Flash_Point: | 166.9±25.9 °C |
| Refractive_Index: | 1.572 |
| Bolling_Point: | 352.3±35.0 °C at 760 mmHg |
| PSA: | 56.65000 |
| Exact_Mass: | 120.032364 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| LogP: | -0.89 |
| Melting_Point: | 90-94ºC |
| Density: | 1.3±0.1 g/cm3 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Hazard_Codes: | Xi:Irritant; |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)