2-Dimethoxymethyl-[1,8]naphthyridine
Catalog No: FT-0677577
CAS No: 204452-90-4
- Molecular Formula: 204.22
- Formula Weight: C11H12N2O2
- Inchl Key: SVSHWQZULQIOEI-UHFFFAOYSA-N
- Inchl: InChI=1S/C11H12N2O2/c1-14-11(15-2)9-6-5-8-4-3-7-12-10(8)13-9/h3-7,11H,1-2H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 204.225 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 204452-90-4 |
| Bolling_Point: | 283.0±35.0 °C at 760 mmHg |
| Product_Name: | 2-(Dimethoxymethyl)-1,8-naphthyridine |
| Melting_Point: | 79-82ºC |
| Flash_Point: | 103.8±16.2 °C |
| MF: | C11H12N2O2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 0.94 |
| Flash_Point: | 103.8±16.2 °C |
| Melting_Point: | 79-82ºC |
| FW: | 204.225 |
| PSA: | 44.24000 |
| Exact_Mass: | 204.089874 |
| MF: | C11H12N2O2 |
| Bolling_Point: | 283.0±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.586 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)