6,8-Dimethylquinolin-4-ol
Catalog No: FT-0692845
CAS No: 203626-58-8
- Chemical Name: 6,8-Dimethylquinolin-4-ol
- Molecular Formula: C11H11NO
- Molecular Weight: 173.21
- InChI Key: ZZARGBMKKDISDN-UHFFFAOYSA-N
- InChI: InChI=1S/C11H11NO/c1-7-5-8(2)11-9(6-7)10(13)3-4-12-11/h3-6H,1-2H3,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 173.21100 |
| Density: | 1.172g/cm3 |
| CAS: | 203626-58-8 |
| Bolling_Point: | 336.2ºC at 760 mmHg |
| Product_Name: | 6,8-dimethyl-1H-quinolin-4-one |
| Melting_Point: | N/A |
| Flash_Point: | 157.2ºC |
| MF: | C11H11NO |
| Density: | 1.172g/cm3 |
|---|---|
| LogP: | 2.55720 |
| Flash_Point: | 157.2ºC |
| Refractive_Index: | 1.647 |
| FW: | 173.21100 |
| PSA: | 33.12000 |
| MF: | C11H11NO |
| Bolling_Point: | 336.2ºC at 760 mmHg |
| Vapor_Pressure: | 5.82E-05mmHg at 25°C |
| Exact_Mass: | 173.08400 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)