Ritalinic acid
Catalog No: FT-0653505
CAS No: 19395-41-6
- Chemical Name: Ritalinic acid
- Molecular Formula: C13H17NO2
- Molecular Weight: 219.28
- InChI Key: INGSNVSERUZOAK-UHFFFAOYSA-N
- InChI: InChI=1S/C13H17NO2/c15-13(16)12(10-6-2-1-3-7-10)11-8-4-5-9-14-11/h1-3,6-7,11-12,14H,4-5,8-9H2,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 19395-41-6 |
| Flash_Point: | 176.2±20.9 °C |
| Product_Name: | Ritalinic acid |
| Bolling_Point: | 367.7±17.0 °C at 760 mmHg |
| FW: | 219.280 |
| Melting_Point: | 236-238ºC |
| MF: | C13H17NO2 |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.554 |
|---|---|
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 176.2±20.9 °C |
| LogP: | 2.08 |
| Bolling_Point: | 367.7±17.0 °C at 760 mmHg |
| FW: | 219.280 |
| PSA: | 49.33000 |
| Melting_Point: | 236-238ºC |
| MF: | C13H17NO2 |
| Exact_Mass: | 219.125931 |
| Density: | 1.1±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36 |
| HS_Code: | 2933399090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)