5-Bromopyridine-2-acetic acid
Catalog No: FT-0679901
CAS No: 192642-85-6
- Chemical Name: 5-Bromopyridine-2-acetic acid
- Molecular Formula: C7H6BrNO2
- Molecular Weight: 216.03
- InChI Key: ATKULCGQSLCGEK-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrNO2/c8-5-1-2-6(9-4-5)3-7(10)11/h1-2,4H,3H2,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 216.032 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 192642-85-6 |
| Bolling_Point: | 326.2±27.0 °C at 760 mmHg |
| Product_Name: | 2-(5-Bromopyridin-2-yl)acetic acid |
| Melting_Point: | N/A |
| Flash_Point: | 151.1±23.7 °C |
| MF: | C7H6BrNO2 |
| Density: | 1.7±0.1 g/cm3 |
|---|---|
| LogP: | 1.04 |
| Flash_Point: | 151.1±23.7 °C |
| Refractive_Index: | 1.599 |
| FW: | 216.032 |
| PSA: | 50.19000 |
| MF: | C7H6BrNO2 |
| Bolling_Point: | 326.2±27.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 214.958176 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)