3-Cyano-7-hydroxycoumarin
Catalog No: FT-0615549
CAS No: 19088-73-4
- Chemical Name: 3-Cyano-7-hydroxycoumarin
- Molecular Formula: C10H5NO3
- Molecular Weight: 187.15
- InChI Key: IJQYTHQDUDCJEQ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H5NO3/c11-5-7-3-6-1-2-8(12)4-9(6)14-10(7)13/h1-4,12H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 19088-73-4 |
| Flash_Point: | 217.8ºC |
| Product_Name: | 3-Cyanoumbelliferone |
| Bolling_Point: | 436.6ºC at 760 mmHg |
| FW: | 187.15200 |
| Melting_Point: | ≥250ºC(lit.) |
| MF: | C10H5NO3 |
| Density: | 1.5 g/cm3 |
| Melting_Point: | ≥250ºC(lit.) |
|---|---|
| Refractive_Index: | 1.667 |
| Vapor_Pressure: | 3.13E-08mmHg at 25°C |
| MF: | C10H5NO3 |
| Flash_Point: | 217.8ºC |
| LogP: | 1.37028 |
| FW: | 187.15200 |
| Density: | 1.5 g/cm3 |
| PSA: | 74.23000 |
| Bolling_Point: | 436.6ºC at 760 mmHg |
| Exact_Mass: | 187.02700 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R20/21/22 |
| HS_Code: | 2932209090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302 + H312 + H332-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)